About N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide
N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 71761820) has the molecular formula C23H20ClN3O2
and a molecular weight of 405.89 g/mol. Its IUPAC name is N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
| PubChem CID | 71761820 |
| Molecular Formula | C23H20ClN3O2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1ccn2c(C(=O)NCc3ccc(Oc4ccc(Cl)cc4)cc3)c(C)nc2c1 |
| InChI | InChI=1S/C23H20ClN3O2/c1-15-11-12-27-21(13-15)26-16(2)22(27)23(28)25-14-17-3-7-19(8-4-17)29-20-9-5-18(24)6-10-20/h3-13H,14H2,1-2H3,(H,25,28) |
| InChIKey | LTFYEUARLCFXFH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide?
The IUPAC name of N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide (CID 71761820) is N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide.
What is the SMILES notation for N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide?
The canonical SMILES for N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide is Cc1ccn2c(C(=O)NCc3ccc(Oc4ccc(Cl)cc4)cc3)c(C)nc2c1.
What is the InChIKey of N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide?
The InChIKey is LTFYEUARLCFXFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20ClN3O2/c1-15-11-12-27-21(13-15)26-16(2)22(27)23(28)25-14-17-3-7-19(8-4-17)29-20-9-5-18(24)6-10-20/h3-13H,14H2,1-2H3,(H,25,28).
What are the key properties of N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide?
N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide has a molecular weight of 405.89 g/mol, XLogP of 5.33, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(4-chlorophenoxy)phenyl]methyl]-2,7-dimethylimidazo[1,2-a]pyridine-3-carboxamide is sourced from PubChem (CID 71761820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).