C16H21F3O4 — CID 71761861
(1R,2R,3E,7S,11E,13S,15S)-2,15-dihydroxy-7-(trifluoromethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one (PubChem CID 71761861) has the molecular formula C16H21F3O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is (1R,2R,3E,7S,11E,13S,15S)-2,15-dihydroxy-7-(trifluoromethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one.
| Compound Name | (1R,2R,3E,7S,11E,13S,15S)-2,15-dihydroxy-7-(trifluoromethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
|---|---|
| PubChem CID | 71761861 |
| Molecular Formula | C16H21F3O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (1R,2R,3E,7S,11E,13S,15S)-2,15-dihydroxy-7-(trifluoromethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
| SMILES | O=C1/C=C/[C@@H](O)[C@@H]2C[C@@H](O)C[C@H]2/C=C/CCC[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C16H21F3O4/c17-16(18,19)14-5-3-1-2-4-10-8-11(20)9-12(10)13(21)6-7-15(22)23-14/h2,4,6-7,10-14,20-21H,1,3,5,8-9H2/b4-2+,7-6+/t10-,11+,12-,13-,14+/m1/s1 |
| InChIKey | XNYHWEVYDZHFQM-IVQYTWMYSA-N |
| XLogP | 2.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|