C18H35IO2Si — CID 71762534
(E,3R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3,7-dimethyldec-8-en-2-one (PubChem CID 71762534) has the molecular formula C18H35IO2Si and a molecular weight of 438.47 g/mol. Its IUPAC name is (E,3R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3,7-dimethyldec-8-en-2-one.
| Compound Name | (E,3R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3,7-dimethyldec-8-en-2-one |
|---|---|
| PubChem CID | 71762534 |
| Molecular Formula | C18H35IO2Si |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (E,3R,6R,7S)-6-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3,7-dimethyldec-8-en-2-one |
| SMILES | CC(=O)[C@H](C)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C(\C)I |
| InChI | InChI=1S/C18H35IO2Si/c1-13(16(4)20)10-11-17(14(2)12-15(3)19)21-22(8,9)18(5,6)7/h12-14,17H,10-11H2,1-9H3/b15-12+/t13-,14+,17-/m1/s1 |
| InChIKey | HPQUCRJTNBPJRO-UEEJZYEBSA-N |
| XLogP | 6.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|