C23H49IO2Si2 — CID 71762535
tert-butyl-[(E,2R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2,6-dimethylnon-7-enoxy]-dimethylsilane (PubChem CID 71762535) has the molecular formula C23H49IO2Si2 and a molecular weight of 540.72 g/mol. Its IUPAC name is tert-butyl-[(E,2R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2,6-dimethylnon-7-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,2R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2,6-dimethylnon-7-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 71762535 |
| Molecular Formula | C23H49IO2Si2 |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | tert-butyl-[(E,2R,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodo-2,6-dimethylnon-7-enoxy]-dimethylsilane |
| SMILES | C/C(I)=C\[C@H](C)[C@@H](CC[C@@H](C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H49IO2Si2/c1-18(17-25-27(10,11)22(4,5)6)14-15-21(19(2)16-20(3)24)26-28(12,13)23(7,8)9/h16,18-19,21H,14-15,17H2,1-13H3/b20-16+/t18-,19+,21-/m1/s1 |
| InChIKey | YYNXBZAHHUJZRT-UXBJVNAJSA-N |
| XLogP | 8.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|