C21H44O3Si2 — CID 71762688
tert-butyl-[[(2S,3R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-prop-2-enyloxolan-3-yl]methoxy]-dimethylsilane (PubChem CID 71762688) has the molecular formula C21H44O3Si2 and a molecular weight of 400.75 g/mol. Its IUPAC name is tert-butyl-[[(2S,3R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-prop-2-enyloxolan-3-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,3R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-prop-2-enyloxolan-3-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 71762688 |
| Molecular Formula | C21H44O3Si2 |
| Molecular Weight | 400.75 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | tert-butyl-[[(2S,3R,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-prop-2-enyloxolan-3-yl]methoxy]-dimethylsilane |
| SMILES | C=CC[C@H]1C[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H44O3Si2/c1-12-13-18-14-17(15-22-25(8,9)20(2,3)4)19(24-18)16-23-26(10,11)21(5,6)7/h12,17-19H,1,13-16H2,2-11H3/t17-,18+,19-/m1/s1 |
| InChIKey | TXUFWPCLZPPQML-CEXWTWQISA-N |
| XLogP | 6.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.75 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|