C29H54O6Si2 — CID 71762760
(1R,2R,3E,7R,11E,13S,15S)-2,15-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[(1R)-1,2-dihydroxyethyl]-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one (PubChem CID 71762760) has the molecular formula C29H54O6Si2 and a molecular weight of 554.92 g/mol. Its IUPAC name is (1R,2R,3E,7R,11E,13S,15S)-2,15-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[(1R)-1,2-dihydroxyethyl]-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one.
| Compound Name | (1R,2R,3E,7R,11E,13S,15S)-2,15-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[(1R)-1,2-dihydroxyethyl]-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
|---|---|
| PubChem CID | 71762760 |
| Molecular Formula | C29H54O6Si2 |
| Molecular Weight | 554.92 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | (1R,2R,3E,7R,11E,13S,15S)-2,15-bis[[tert-butyl(dimethyl)silyl]oxy]-7-[(1R)-1,2-dihydroxyethyl]-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2[C@H](/C=C/CCC[C@H]([C@H](O)CO)OC(=O)/C=C/[C@H]2O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C29H54O6Si2/c1-28(2,3)36(7,8)34-22-18-21-14-12-11-13-15-26(24(31)20-30)33-27(32)17-16-25(23(21)19-22)35-37(9,10)29(4,5)6/h12,14,16-17,21-26,30-31H,11,13,15,18-20H2,1-10H3/b14-12+,17-16+/t21-,22+,23-,24-,25-,26-/m1/s1 |
| InChIKey | ACUNGBMRMNYDGN-FYJSKBDQSA-N |
| XLogP | 6.35 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.92 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|