C21H42O4Si2 — CID 71762900
(2S,3aR,10aS)-6,6,8,8-tetra(propan-2-yl)-2-prop-2-enyl-2,3,3a,4,10,10a-hexahydrofuro[2,3-g][1,3,5,2,4]trioxadisilonine (PubChem CID 71762900) has the molecular formula C21H42O4Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is (2S,3aR,10aS)-6,6,8,8-tetra(propan-2-yl)-2-prop-2-enyl-2,3,3a,4,10,10a-hexahydrofuro[2,3-g][1,3,5,2,4]trioxadisilonine.
| Compound Name | (2S,3aR,10aS)-6,6,8,8-tetra(propan-2-yl)-2-prop-2-enyl-2,3,3a,4,10,10a-hexahydrofuro[2,3-g][1,3,5,2,4]trioxadisilonine |
|---|---|
| PubChem CID | 71762900 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | (2S,3aR,10aS)-6,6,8,8-tetra(propan-2-yl)-2-prop-2-enyl-2,3,3a,4,10,10a-hexahydrofuro[2,3-g][1,3,5,2,4]trioxadisilonine |
| SMILES | C=CC[C@H]1C[C@@H]2CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@H]2O1 |
| InChI | InChI=1S/C21H42O4Si2/c1-10-11-20-12-19-13-22-26(15(2)3,16(4)5)25-27(17(6)7,18(8)9)23-14-21(19)24-20/h10,15-21H,1,11-14H2,2-9H3/t19-,20+,21-/m1/s1 |
| InChIKey | WDNYZGYTNSRKNA-QHAWAJNXSA-N |
| XLogP | 5.92 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|