C18H28O5 — CID 71763191
(1R,2R,3E,7R,11E,13S,15S)-2,15-dihydroxy-7-(2-methoxyethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one (PubChem CID 71763191) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1R,2R,3E,7R,11E,13S,15S)-2,15-dihydroxy-7-(2-methoxyethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one.
| Compound Name | (1R,2R,3E,7R,11E,13S,15S)-2,15-dihydroxy-7-(2-methoxyethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
|---|---|
| PubChem CID | 71763191 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (1R,2R,3E,7R,11E,13S,15S)-2,15-dihydroxy-7-(2-methoxyethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
| SMILES | COCC[C@H]1CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@H](O)/C=C/C(=O)O1 |
| InChI | InChI=1S/C18H28O5/c1-22-10-9-15-6-4-2-3-5-13-11-14(19)12-16(13)17(20)7-8-18(21)23-15/h3,5,7-8,13-17,19-20H,2,4,6,9-12H2,1H3/b5-3+,8-7+/t13-,14+,15-,16-,17-/m1/s1 |
| InChIKey | YRNWYOCZYBQCDE-QFUPPCKTSA-N |
| XLogP | 1.98 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|