C24H32O5 — CID 71763192
(1R,2R,3E,7R,11E,13S,15S)-2,15-dihydroxy-7-(2-phenylmethoxyethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one (PubChem CID 71763192) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is (1R,2R,3E,7R,11E,13S,15S)-2,15-dihydroxy-7-(2-phenylmethoxyethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one.
| Compound Name | (1R,2R,3E,7R,11E,13S,15S)-2,15-dihydroxy-7-(2-phenylmethoxyethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
|---|---|
| PubChem CID | 71763192 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (1R,2R,3E,7R,11E,13S,15S)-2,15-dihydroxy-7-(2-phenylmethoxyethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
| SMILES | O=C1/C=C/[C@@H](O)[C@@H]2C[C@@H](O)C[C@H]2/C=C/CCC[C@H](CCOCc2ccccc2)O1 |
| InChI | InChI=1S/C24H32O5/c25-20-15-19-9-5-2-6-10-21(13-14-28-17-18-7-3-1-4-8-18)29-24(27)12-11-23(26)22(19)16-20/h1,3-5,7-9,11-12,19-23,25-26H,2,6,10,13-17H2/b9-5+,12-11+/t19-,20+,21-,22-,23-/m1/s1 |
| InChIKey | NNPOPIWCZIERSZ-DJLXOVMMSA-N |
| XLogP | 3.55 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|