C20H6N4O4 — CID 71763219
2-[[3-(2,2-dicyanoethenyl)-4,6-dioxopyrano[3,2-g]chromen-7-yl]methylidene]propanedinitrile (PubChem CID 71763219) has the molecular formula C20H6N4O4 and a molecular weight of 366.29 g/mol. Its IUPAC name is 2-[[3-(2,2-dicyanoethenyl)-4,6-dioxopyrano[3,2-g]chromen-7-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[3-(2,2-dicyanoethenyl)-4,6-dioxopyrano[3,2-g]chromen-7-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 71763219 |
| Molecular Formula | C20H6N4O4 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 2-[[3-(2,2-dicyanoethenyl)-4,6-dioxopyrano[3,2-g]chromen-7-yl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1coc2cc3occ(C=C(C#N)C#N)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C20H6N4O4/c21-5-11(6-22)1-13-9-27-17-4-18-16(3-15(17)19(13)25)20(26)14(10-28-18)2-12(7-23)8-24/h1-4,9-10H |
| InChIKey | KWTKOVIIBCXMIK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 155.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|