C23H30O4 — CID 71763648
(1R,2R,3E,7R,11E,13S,15S)-2,15-dihydroxy-7-(2-phenylethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one (PubChem CID 71763648) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (1R,2R,3E,7R,11E,13S,15S)-2,15-dihydroxy-7-(2-phenylethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one.
| Compound Name | (1R,2R,3E,7R,11E,13S,15S)-2,15-dihydroxy-7-(2-phenylethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
|---|---|
| PubChem CID | 71763648 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (1R,2R,3E,7R,11E,13S,15S)-2,15-dihydroxy-7-(2-phenylethyl)-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
| SMILES | O=C1/C=C/[C@@H](O)[C@@H]2C[C@@H](O)C[C@H]2/C=C/CCC[C@H](CCc2ccccc2)O1 |
| InChI | InChI=1S/C23H30O4/c24-19-15-18-9-5-2-6-10-20(12-11-17-7-3-1-4-8-17)27-23(26)14-13-22(25)21(18)16-19/h1,3-5,7-9,13-14,18-22,24-25H,2,6,10-12,15-16H2/b9-5+,14-13+/t18-,19+,20-,21-,22-/m1/s1 |
| InChIKey | CSSYWQYQCALYND-SAADUKRKSA-N |
| XLogP | 3.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|