C31H35F3O8S2Si — CID 71763734
[(2R,3R,4S,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-6-phenylsulfanyl-5-(trifluoromethylsulfonyloxy)oxan-4-yl] acetate (PubChem CID 71763734) has the molecular formula C31H35F3O8S2Si and a molecular weight of 684.83 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-6-phenylsulfanyl-5-(trifluoromethylsulfonyloxy)oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-6-phenylsulfanyl-5-(trifluoromethylsulfonyloxy)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 71763734 |
| Molecular Formula | C31H35F3O8S2Si |
| Molecular Weight | 684.83 g/mol |
| Exact Mass | 684.15 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-6-phenylsulfanyl-5-(trifluoromethylsulfonyloxy)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](Sc2ccccc2)[C@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C31H35F3O8S2Si/c1-21(35)40-27-26(36)25(41-29(43-22-14-8-5-9-15-22)28(27)42-44(37,38)31(32,33)34)20-39-45(30(2,3)4,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-19,25-29,36H,20H2,1-4H3/t25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | CFFBBDYQACPBNW-PNHLWVRCSA-N |
| XLogP | 4.61 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|