C25H52O3Si2 — CID 71763738
4-[(1R,3R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2,6-trimethylcyclohexyl]butan-2-one (PubChem CID 71763738) has the molecular formula C25H52O3Si2 and a molecular weight of 456.86 g/mol. Its IUPAC name is 4-[(1R,3R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2,6-trimethylcyclohexyl]butan-2-one.
| Compound Name | 4-[(1R,3R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2,6-trimethylcyclohexyl]butan-2-one |
|---|---|
| PubChem CID | 71763738 |
| Molecular Formula | C25H52O3Si2 |
| Molecular Weight | 456.86 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | 4-[(1R,3R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2,6-trimethylcyclohexyl]butan-2-one |
| SMILES | CC(=O)CC[C@@H]1C(C)(C)[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]1(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O3Si2/c1-19(26)15-16-20-24(8,9)21(27-29(11,12)22(2,3)4)17-18-25(20,10)28-30(13,14)23(5,6)7/h20-21H,15-18H2,1-14H3/t20-,21-,25+/m1/s1 |
| InChIKey | LOQQEVWLAVTCML-OTPAQWSUSA-N |
| XLogP | 7.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.86 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|