About 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one
3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one (PubChem CID 71764026) has the molecular formula C24H26N4O2
and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one.
Molecular Properties
| Compound Name | 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one |
| PubChem CID | 71764026 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one |
| SMILES | COc1ccc(-c2nc3c4cc(C)ccc4c(=O)[nH]n3c2NC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H26N4O2/c1-15-8-13-19-20(14-15)22-26-21(16-9-11-18(30-2)12-10-16)23(28(22)27-24(19)29)25-17-6-4-3-5-7-17/h8-14,17,25H,3-7H2,1-2H3,(H,27,29) |
| InChIKey | RVWWCADJQTWVBA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one?
The IUPAC name of 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one (CID 71764026) is 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one.
What is the SMILES notation for 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one?
The canonical SMILES for 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one is COc1ccc(-c2nc3c4cc(C)ccc4c(=O)[nH]n3c2NC2CCCCC2)cc1.
What is the InChIKey of 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one?
The InChIKey is RVWWCADJQTWVBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N4O2/c1-15-8-13-19-20(14-15)22-26-21(16-9-11-18(30-2)12-10-16)23(28(22)27-24(19)29)25-17-6-4-3-5-7-17/h8-14,17,25H,3-7H2,1-2H3,(H,27,29).
What are the key properties of 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one?
3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one has a molecular weight of 402.50 g/mol, XLogP of 4.90, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexylamino)-2-(4-methoxyphenyl)-9-methyl-5H-imidazo[2,1-a]phthalazin-6-one is sourced from PubChem (CID 71764026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).