C35H32F6N2O5 — CID 71764073
[(2S)-2-[[(3aR,4R,5S,7aS)-4-(2-methylphenyl)-2-(4-oxo-1,3-oxazol-2-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]-2-[3,5-bis(trifluoromethyl)phenyl]ethyl] benzoate (PubChem CID 71764073) has the molecular formula C35H32F6N2O5 and a molecular weight of 674.64 g/mol. Its IUPAC name is [(2S)-2-[[(3aR,4R,5S,7aS)-4-(2-methylphenyl)-2-(4-oxo-1,3-oxazol-2-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]-2-[3,5-bis(trifluoromethyl)phenyl]ethyl] benzoate.
| Compound Name | [(2S)-2-[[(3aR,4R,5S,7aS)-4-(2-methylphenyl)-2-(4-oxo-1,3-oxazol-2-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]-2-[3,5-bis(trifluoromethyl)phenyl]ethyl] benzoate |
|---|---|
| PubChem CID | 71764073 |
| Molecular Formula | C35H32F6N2O5 |
| Molecular Weight | 674.64 g/mol |
| Exact Mass | 674.22 |
| IUPAC Name | [(2S)-2-[[(3aR,4R,5S,7aS)-4-(2-methylphenyl)-2-(4-oxo-1,3-oxazol-2-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]-2-[3,5-bis(trifluoromethyl)phenyl]ethyl] benzoate |
| SMILES | Cc1ccccc1[C@H]1[C@@H]2CN(C3=NC(=O)CO3)C[C@H]2CC[C@@H]1O[C@H](COC(=O)c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C35H32F6N2O5/c1-20-7-5-6-10-26(20)31-27-17-43(33-42-30(44)19-47-33)16-22(27)11-12-28(31)48-29(18-46-32(45)21-8-3-2-4-9-21)23-13-24(34(36,37)38)15-25(14-23)35(39,40)41/h2-10,13-15,22,27-29,31H,11-12,16-19H2,1H3/t22-,27-,28+,29-,31+/m1/s1 |
| InChIKey | HTBZSWICZWHQKO-JRHHORLMSA-N |
| XLogP | 7.35 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.64 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |