C13H22N4O3 — CID 71764079
[1-(4,6-diethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol (PubChem CID 71764079) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is [1-(4,6-diethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol.
| Compound Name | [1-(4,6-diethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 71764079 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | [1-(4,6-diethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]methanol |
| SMILES | CCOc1nc(OCC)nc(N2CCC(CO)CC2)n1 |
| InChI | InChI=1S/C13H22N4O3/c1-3-19-12-14-11(15-13(16-12)20-4-2)17-7-5-10(9-18)6-8-17/h10,18H,3-9H2,1-2H3 |
| InChIKey | YWCNGLDRPARRTG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |