C18H23NO3S — CID 71764115
(3R,4R)-3-(cyclopenten-1-yl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbaldehyde (PubChem CID 71764115) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is (3R,4R)-3-(cyclopenten-1-yl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbaldehyde.
| Compound Name | (3R,4R)-3-(cyclopenten-1-yl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 71764115 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (3R,4R)-3-(cyclopenten-1-yl)-1-(4-methylphenyl)sulfonylpiperidine-4-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H](C=O)[C@H](C3=CCCC3)C2)cc1 |
| InChI | InChI=1S/C18H23NO3S/c1-14-6-8-17(9-7-14)23(21,22)19-11-10-16(13-20)18(12-19)15-4-2-3-5-15/h4,6-9,13,16,18H,2-3,5,10-12H2,1H3/t16-,18-/m0/s1 |
| InChIKey | MVCPIHVHLABKHJ-WMZOPIPTSA-N |
| XLogP | 2.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|