C24H18BF5N2O2 — CID 71764142
2,2-difluoro-4,12-bis(4-methoxyphenyl)-8-(trifluoromethyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 71764142) has the molecular formula C24H18BF5N2O2 and a molecular weight of 472.22 g/mol. Its IUPAC name is 2,2-difluoro-4,12-bis(4-methoxyphenyl)-8-(trifluoromethyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,12-bis(4-methoxyphenyl)-8-(trifluoromethyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 71764142 |
| Molecular Formula | C24H18BF5N2O2 |
| Molecular Weight | 472.22 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2,2-difluoro-4,12-bis(4-methoxyphenyl)-8-(trifluoromethyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | COc1ccc(C2=[N+]3C(=C(C(F)(F)F)c4ccc(-c5ccc(OC)cc5)n4[B-]3(F)F)C=C2)cc1 |
| InChI | InChI=1S/C24H18BF5N2O2/c1-33-17-7-3-15(4-8-17)19-11-13-21-23(24(26,27)28)22-14-12-20(32(22)25(29,30)31(19)21)16-5-9-18(34-2)10-6-16/h3-14H,1-2H3 |
| InChIKey | YAVOYEUZOHFXQN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.22 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|