C23H42O6Si — CID 71764469
9-O-tert-butyl 1-O-methyl (E,2S,6E)-2-hydroxy-2-[(1R,2S)-1-hydroxy-2-methylbutyl]-6-(trimethylsilylmethylidene)non-3-enedioate (PubChem CID 71764469) has the molecular formula C23H42O6Si and a molecular weight of 442.67 g/mol. Its IUPAC name is 9-O-tert-butyl 1-O-methyl (E,2S,6E)-2-hydroxy-2-[(1R,2S)-1-hydroxy-2-methylbutyl]-6-(trimethylsilylmethylidene)non-3-enedioate.
| Compound Name | 9-O-tert-butyl 1-O-methyl (E,2S,6E)-2-hydroxy-2-[(1R,2S)-1-hydroxy-2-methylbutyl]-6-(trimethylsilylmethylidene)non-3-enedioate |
|---|---|
| PubChem CID | 71764469 |
| Molecular Formula | C23H42O6Si |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 9-O-tert-butyl 1-O-methyl (E,2S,6E)-2-hydroxy-2-[(1R,2S)-1-hydroxy-2-methylbutyl]-6-(trimethylsilylmethylidene)non-3-enedioate |
| SMILES | CC[C@H](C)[C@@H](O)[C@@](O)(/C=C/C/C(=C/[Si](C)(C)C)CCC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C23H42O6Si/c1-10-17(2)20(25)23(27,21(26)28-6)15-11-12-18(16-30(7,8)9)13-14-19(24)29-22(3,4)5/h11,15-17,20,25,27H,10,12-14H2,1-9H3/b15-11+,18-16-/t17-,20+,23-/m0/s1 |
| InChIKey | NGIQGNRSZDFHFS-XJDLRAIISA-N |
| XLogP | 4.17 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|