C14H16F5N3O2S — CID 71765290
1-(4-methyl-2-pyridinyl)-4-[(E)-3,3,4,4,4-pentafluorobut-1-enyl]sulfonylpiperazine (PubChem CID 71765290) has the molecular formula C14H16F5N3O2S and a molecular weight of 385.36 g/mol. Its IUPAC name is 1-(4-methyl-2-pyridinyl)-4-[(E)-3,3,4,4,4-pentafluorobut-1-enyl]sulfonylpiperazine.
| Compound Name | 1-(4-methyl-2-pyridinyl)-4-[(E)-3,3,4,4,4-pentafluorobut-1-enyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 71765290 |
| Molecular Formula | C14H16F5N3O2S |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 1-(4-methyl-2-pyridinyl)-4-[(E)-3,3,4,4,4-pentafluorobut-1-enyl]sulfonylpiperazine |
| SMILES | Cc1ccnc(N2CCN(S(=O)(=O)/C=C/C(F)(F)C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C14H16F5N3O2S/c1-11-2-4-20-12(10-11)21-5-7-22(8-6-21)25(23,24)9-3-13(15,16)14(17,18)19/h2-4,9-10H,5-8H2,1H3/b9-3+ |
| InChIKey | HIUBYXMFRQOJPP-YCRREMRBSA-N |
| XLogP | 2.55 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|