C26H26FN3O4 — CID 71765813
methyl 4-[(2-fluoro-4-pyridinyl)-(4-methylpiperazin-1-yl)methyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylate (PubChem CID 71765813) has the molecular formula C26H26FN3O4 and a molecular weight of 463.51 g/mol. Its IUPAC name is methyl 4-[(2-fluoro-4-pyridinyl)-(4-methylpiperazin-1-yl)methyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylate.
| Compound Name | methyl 4-[(2-fluoro-4-pyridinyl)-(4-methylpiperazin-1-yl)methyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 71765813 |
| Molecular Formula | C26H26FN3O4 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | methyl 4-[(2-fluoro-4-pyridinyl)-(4-methylpiperazin-1-yl)methyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc2c1c(C(c1ccnc(F)c1)N1CCN(C)CC1)c(O)c1ccccc12 |
| InChI | InChI=1S/C26H26FN3O4/c1-15-20(26(32)33-3)21-22(24(31)17-6-4-5-7-18(17)25(21)34-15)23(16-8-9-28-19(27)14-16)30-12-10-29(2)11-13-30/h4-9,14,23,31H,10-13H2,1-3H3 |
| InChIKey | ZEVGWZAPXRKSHU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|