C25H23F2N3O4 — CID 71765964
7-fluoro-4-[(2-fluoro-4-pyridinyl)-(4-methylpiperazin-1-yl)methyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylic acid (PubChem CID 71765964) has the molecular formula C25H23F2N3O4 and a molecular weight of 467.47 g/mol. Its IUPAC name is 7-fluoro-4-[(2-fluoro-4-pyridinyl)-(4-methylpiperazin-1-yl)methyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylic acid.
| Compound Name | 7-fluoro-4-[(2-fluoro-4-pyridinyl)-(4-methylpiperazin-1-yl)methyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 71765964 |
| Molecular Formula | C25H23F2N3O4 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 7-fluoro-4-[(2-fluoro-4-pyridinyl)-(4-methylpiperazin-1-yl)methyl]-5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylic acid |
| SMILES | Cc1oc2c(c1C(=O)O)c(C(c1ccnc(F)c1)N1CCN(C)CC1)c(O)c1cc(F)ccc12 |
| InChI | InChI=1S/C25H23F2N3O4/c1-13-19(25(32)33)20-21(23(31)17-12-15(26)3-4-16(17)24(20)34-13)22(14-5-6-28-18(27)11-14)30-9-7-29(2)8-10-30/h3-6,11-12,22,31H,7-10H2,1-2H3,(H,32,33) |
| InChIKey | WTWHLKYPIDAHSY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|