C22H36Cl2N16 — CID 71765990
1-N',4-N'-bis[4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]butyl]benzene-1,4-dicarboximidamide;dihydrochloride (PubChem CID 71765990) has the molecular formula C22H36Cl2N16 and a molecular weight of 595.55 g/mol. Its IUPAC name is 1-N',4-N'-bis[4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]butyl]benzene-1,4-dicarboximidamide;dihydrochloride.
| Compound Name | 1-N',4-N'-bis[4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]butyl]benzene-1,4-dicarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 71765990 |
| Molecular Formula | C22H36Cl2N16 |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | 1-N',4-N'-bis[4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]butyl]benzene-1,4-dicarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\CCCCNc1nc(N)nc(N)n1)c1ccc(/C(N)=N/CCCCNc2nc(N)nc(N)n2)cc1 |
| InChI | InChI=1S/C22H34N16.2ClH/c23-15(29-9-1-3-11-31-21-35-17(25)33-18(26)36-21)13-5-7-14(8-6-13)16(24)30-10-2-4-12-32-22-37-19(27)34-20(28)38-22;;/h5-8H,1-4,9-12H2,(H2,23,29)(H2,24,30)(H5,25,26,31,33,35,36)(H5,27,28,32,34,37,38);2*1H |
| InChIKey | FTLBOZMJMFLKCG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 282.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|