About Mitozolomide
Mitozolomide (PubChem CID 71766) has the molecular formula C7H7ClN6O2
and a molecular weight of 242.62 g/mol. Its IUPAC name is 3-(2-chloroethyl)-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide.
Molecular Properties
| Compound Name | Mitozolomide |
| PubChem CID | 71766 |
| Molecular Formula | C7H7ClN6O2 |
| Molecular Weight | 242.62 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 3-(2-chloroethyl)-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| SMILES | C1=NC(=C2N1C(=O)N(N=N2)CCCl)C(=O)N |
| InChI | InChI=1S/C7H7ClN6O2/c8-1-2-14-7(16)13-3-10-4(5(9)15)6(13)11-12-14/h3H,1-2H2,(H2,9,15) |
| InChIKey | QXYYYPFGTSJXNS-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 348 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.62 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze Mitozolomide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Mitozolomide?
The IUPAC name of Mitozolomide (CID 71766) is 3-(2-chloroethyl)-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide.
What is the SMILES notation for Mitozolomide?
The canonical SMILES for Mitozolomide is C1=NC(=C2N1C(=O)N(N=N2)CCCl)C(=O)N.
What is the InChIKey of Mitozolomide?
The InChIKey is QXYYYPFGTSJXNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN6O2/c8-1-2-14-7(16)13-3-10-4(5(9)15)6(13)11-12-14/h3H,1-2H2,(H2,9,15).
What are the key properties of Mitozolomide?
Mitozolomide has a molecular weight of 242.62 g/mol, XLogP of -0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Mitozolomide is sourced from PubChem (CID 71766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).