C29H31FNO8+ — CID 71766080
2-(2-(18F)fluoroethyl)-2-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]propanedioic acid (PubChem CID 71766080) has the molecular formula C29H31FNO8+ and a molecular weight of 539.57 g/mol. Its IUPAC name is 2-(2-(18F)fluoroethyl)-2-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]propanedioic acid.
| Compound Name | 2-(2-(18F)fluoroethyl)-2-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]propanedioic acid |
|---|---|
| PubChem CID | 71766080 |
| Molecular Formula | C29H31FNO8+ |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 2-(2-(18F)fluoroethyl)-2-[5-[(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)oxy]pentyl]propanedioic acid |
| SMILES | COc1ccc2cc3[n+](cc2c1OCCCCCC(CC[18F])(C(=O)O)C(=O)O)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C29H30FNO8/c1-36-23-6-5-18-13-22-20-15-25-24(38-17-39-25)14-19(20)7-11-31(22)16-21(18)26(23)37-12-4-2-3-8-29(9-10-30,27(32)33)28(34)35/h5-6,13-16H,2-4,7-12,17H2,1H3,(H-,32,33,34,35)/p+1/i30-1 |
| InChIKey | NSRMXWMERQMGRC-IZYGCTIASA-O |
| XLogP | 4.54 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|