C25H24FN3O4 — CID 71766395
methyl 6-fluoro-5-hydroxy-4-[(4-methylpiperazin-1-yl)-pyridin-4-ylmethyl]benzo[g][1]benzofuran-3-carboxylate (PubChem CID 71766395) has the molecular formula C25H24FN3O4 and a molecular weight of 449.48 g/mol. Its IUPAC name is methyl 6-fluoro-5-hydroxy-4-[(4-methylpiperazin-1-yl)-pyridin-4-ylmethyl]benzo[g][1]benzofuran-3-carboxylate.
| Compound Name | methyl 6-fluoro-5-hydroxy-4-[(4-methylpiperazin-1-yl)-pyridin-4-ylmethyl]benzo[g][1]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 71766395 |
| Molecular Formula | C25H24FN3O4 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | methyl 6-fluoro-5-hydroxy-4-[(4-methylpiperazin-1-yl)-pyridin-4-ylmethyl]benzo[g][1]benzofuran-3-carboxylate |
| SMILES | COC(=O)c1coc2c1c(C(c1ccncc1)N1CCN(C)CC1)c(O)c1c(F)cccc12 |
| InChI | InChI=1S/C25H24FN3O4/c1-28-10-12-29(13-11-28)22(15-6-8-27-9-7-15)21-20-17(25(31)32-2)14-33-24(20)16-4-3-5-18(26)19(16)23(21)30/h3-9,14,22,30H,10-13H2,1-2H3 |
| InChIKey | AXHXFPVMMUGWKU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|