C26H36N2O5 — CID 71766585
ethyl (1S,15R,17R,18S)-17-[2-(2-methoxyethoxymethoxy)ethyl]-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraene-1-carboxylate (PubChem CID 71766585) has the molecular formula C26H36N2O5 and a molecular weight of 456.58 g/mol. Its IUPAC name is ethyl (1S,15R,17R,18S)-17-[2-(2-methoxyethoxymethoxy)ethyl]-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraene-1-carboxylate.
| Compound Name | ethyl (1S,15R,17R,18S)-17-[2-(2-methoxyethoxymethoxy)ethyl]-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraene-1-carboxylate |
|---|---|
| PubChem CID | 71766585 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | ethyl (1S,15R,17R,18S)-17-[2-(2-methoxyethoxymethoxy)ethyl]-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4,6,8-tetraene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]3C[C@H](CCOCOCCOC)[C@@H]1N(CCc1c2[nH]c2ccccc12)C3 |
| InChI | InChI=1S/C26H36N2O5/c1-3-33-25(29)26-15-18-14-19(9-11-31-17-32-13-12-30-2)24(26)28(16-18)10-8-21-20-6-4-5-7-22(20)27-23(21)26/h4-7,18-19,24,27H,3,8-17H2,1-2H3/t18-,19+,24+,26-/m1/s1 |
| InChIKey | PANIEPMTNLSKQK-SXGQPBMZSA-N |
| XLogP | 3.26 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|