C19H23N3O2 — CID 71766726
3-[(1-benzylpiperidin-3-yl)methylamino]pyridine-4-carboxylic acid (PubChem CID 71766726) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-[(1-benzylpiperidin-3-yl)methylamino]pyridine-4-carboxylic acid.
| Compound Name | 3-[(1-benzylpiperidin-3-yl)methylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 71766726 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-[(1-benzylpiperidin-3-yl)methylamino]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccncc1NCC1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H23N3O2/c23-19(24)17-8-9-20-12-18(17)21-11-16-7-4-10-22(14-16)13-15-5-2-1-3-6-15/h1-3,5-6,8-9,12,16,21H,4,7,10-11,13-14H2,(H,23,24) |
| InChIKey | CPSDCBCOTHADNH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |