C19H19N3O — CID 71767274
N,N-dimethyl-3-(2-phenylethynyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxamide (PubChem CID 71767274) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-phenylethynyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxamide.
| Compound Name | N,N-dimethyl-3-(2-phenylethynyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxamide |
|---|---|
| PubChem CID | 71767274 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N,N-dimethyl-3-(2-phenylethynyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxamide |
| SMILES | CN(C)C(=O)N1CCc2ncc(C#Cc3ccccc3)cc2C1 |
| InChI | InChI=1S/C19H19N3O/c1-21(2)19(23)22-11-10-18-17(14-22)12-16(13-20-18)9-8-15-6-4-3-5-7-15/h3-7,12-13H,10-11,14H2,1-2H3 |
| InChIKey | YZJQGAWQWDSRRT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|