C21H19F4N5OS — CID 71767612
4-[2-(4-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1-[[5-(trifluoromethyl)thiophen-2-yl]methyl]-1,3,5-triazin-2-one (PubChem CID 71767612) has the molecular formula C21H19F4N5OS and a molecular weight of 465.48 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1-[[5-(trifluoromethyl)thiophen-2-yl]methyl]-1,3,5-triazin-2-one.
| Compound Name | 4-[2-(4-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1-[[5-(trifluoromethyl)thiophen-2-yl]methyl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 71767612 |
| Molecular Formula | C21H19F4N5OS |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 4-[2-(4-fluorophenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-1-[[5-(trifluoromethyl)thiophen-2-yl]methyl]-1,3,5-triazin-2-one |
| SMILES | O=c1nc(N2CC3CN(c4ccc(F)cc4)CC3C2)ncn1Cc1ccc(C(F)(F)F)s1 |
| InChI | InChI=1S/C21H19F4N5OS/c22-15-1-3-16(4-2-15)28-7-13-9-29(10-14(13)8-28)19-26-12-30(20(31)27-19)11-17-5-6-18(32-17)21(23,24)25/h1-6,12-14H,7-11H2 |
| InChIKey | BQAYQLRAVTXCHC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |