C21H19FN2O2 — CID 71767695
methyl (6aR,9aS)-3-[2-(3-fluorophenyl)ethynyl]-5,6a,7,8,9,9a-hexahydrocyclopenta[h][1,6]naphthyridine-6-carboxylate (PubChem CID 71767695) has the molecular formula C21H19FN2O2 and a molecular weight of 350.39 g/mol. Its IUPAC name is methyl (6aR,9aS)-3-[2-(3-fluorophenyl)ethynyl]-5,6a,7,8,9,9a-hexahydrocyclopenta[h][1,6]naphthyridine-6-carboxylate.
| Compound Name | methyl (6aR,9aS)-3-[2-(3-fluorophenyl)ethynyl]-5,6a,7,8,9,9a-hexahydrocyclopenta[h][1,6]naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 71767695 |
| Molecular Formula | C21H19FN2O2 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | methyl (6aR,9aS)-3-[2-(3-fluorophenyl)ethynyl]-5,6a,7,8,9,9a-hexahydrocyclopenta[h][1,6]naphthyridine-6-carboxylate |
| SMILES | COC(=O)N1Cc2cc(C#Cc3cccc(F)c3)cnc2[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C21H19FN2O2/c1-26-21(25)24-13-16-10-15(9-8-14-4-2-5-17(22)11-14)12-23-20(16)18-6-3-7-19(18)24/h2,4-5,10-12,18-19H,3,6-7,13H2,1H3/t18-,19+/m0/s1 |
| InChIKey | RROORMWVEOREKB-RBUKOAKNSA-N |
| XLogP | 3.84 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|