C22H21FN2O2 — CID 71767697
methyl (6aR,10aS)-3-[2-(3-fluorophenyl)ethynyl]-6a,7,8,9,10,10a-hexahydro-5H-benzo[h][1,6]naphthyridine-6-carboxylate (PubChem CID 71767697) has the molecular formula C22H21FN2O2 and a molecular weight of 364.42 g/mol. Its IUPAC name is methyl (6aR,10aS)-3-[2-(3-fluorophenyl)ethynyl]-6a,7,8,9,10,10a-hexahydro-5H-benzo[h][1,6]naphthyridine-6-carboxylate.
| Compound Name | methyl (6aR,10aS)-3-[2-(3-fluorophenyl)ethynyl]-6a,7,8,9,10,10a-hexahydro-5H-benzo[h][1,6]naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 71767697 |
| Molecular Formula | C22H21FN2O2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | methyl (6aR,10aS)-3-[2-(3-fluorophenyl)ethynyl]-6a,7,8,9,10,10a-hexahydro-5H-benzo[h][1,6]naphthyridine-6-carboxylate |
| SMILES | COC(=O)N1Cc2cc(C#Cc3cccc(F)c3)cnc2[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C22H21FN2O2/c1-27-22(26)25-14-17-11-16(10-9-15-5-4-6-18(23)12-15)13-24-21(17)19-7-2-3-8-20(19)25/h4-6,11-13,19-20H,2-3,7-8,14H2,1H3/t19-,20+/m0/s1 |
| InChIKey | RQYLLFSDBSYPEZ-VQTJNVASSA-N |
| XLogP | 4.23 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|