About trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid
trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid (PubChem CID 71767948) has the molecular formula C14H13ClO3S
and a molecular weight of 296.77 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid |
| PubChem CID | 71767948 |
| Molecular Formula | C14H13ClO3S |
| Molecular Weight | 296.77 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H]1C(=O)c1ccc(SC2CC2)c(Cl)c1 |
| InChI | InChI=1S/C14H13ClO3S/c15-11-5-7(1-4-12(11)19-8-2-3-8)13(16)9-6-10(9)14(17)18/h1,4-5,8-10H,2-3,6H2,(H,17,18)/t9-,10-/m0/s1 |
| InChIKey | NNHJEETVGXXKFE-UWVGGRQHSA-N |
| XLogP | 3.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid?
The IUPAC name of trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid (CID 71767948) is trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid is O=C(O)[C@H]1C[C@@H]1C(=O)c1ccc(SC2CC2)c(Cl)c1.
What is the InChIKey of trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid?
The InChIKey is NNHJEETVGXXKFE-UWVGGRQHSA-N. The full InChI is InChI=1S/C14H13ClO3S/c15-11-5-7(1-4-12(11)19-8-2-3-8)13(16)9-6-10(9)14(17)18/h1,4-5,8-10H,2-3,6H2,(H,17,18)/t9-,10-/m0/s1.
What are the key properties of trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid?
trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid has a molecular weight of 296.77 g/mol, XLogP of 3.50, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-2-(3-chloro-4-cyclopropylsulfanylbenzoyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 71767948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).