C20H17FN2O2 — CID 71767993
methyl (2R,6S)-10-[2-(3-fluorophenyl)ethynyl]-4,12-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxylate (PubChem CID 71767993) has the molecular formula C20H17FN2O2 and a molecular weight of 336.37 g/mol. Its IUPAC name is methyl (2R,6S)-10-[2-(3-fluorophenyl)ethynyl]-4,12-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxylate.
| Compound Name | methyl (2R,6S)-10-[2-(3-fluorophenyl)ethynyl]-4,12-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxylate |
|---|---|
| PubChem CID | 71767993 |
| Molecular Formula | C20H17FN2O2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | methyl (2R,6S)-10-[2-(3-fluorophenyl)ethynyl]-4,12-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-4-carboxylate |
| SMILES | COC(=O)N1C[C@H]2Cc3cc(C#Cc4cccc(F)c4)cnc3[C@H]2C1 |
| InChI | InChI=1S/C20H17FN2O2/c1-25-20(24)23-11-16-9-15-7-14(10-22-19(15)18(16)12-23)6-5-13-3-2-4-17(21)8-13/h2-4,7-8,10,16,18H,9,11-12H2,1H3/t16-,18+/m1/s1 |
| InChIKey | PTTGAKZNHKMTQY-AEFFLSMTSA-N |
| XLogP | 2.96 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|