C29H27N3O7S — CID 71768021
ethyl (2S,3R,4R)-3-cyano-4-ethenyl-4-(4-methoxyphenyl)-1-(4-nitrophenyl)sulfonyl-2-phenylpyrrolidine-3-carboxylate (PubChem CID 71768021) has the molecular formula C29H27N3O7S and a molecular weight of 561.62 g/mol. Its IUPAC name is ethyl (2S,3R,4R)-3-cyano-4-ethenyl-4-(4-methoxyphenyl)-1-(4-nitrophenyl)sulfonyl-2-phenylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (2S,3R,4R)-3-cyano-4-ethenyl-4-(4-methoxyphenyl)-1-(4-nitrophenyl)sulfonyl-2-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 71768021 |
| Molecular Formula | C29H27N3O7S |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | ethyl (2S,3R,4R)-3-cyano-4-ethenyl-4-(4-methoxyphenyl)-1-(4-nitrophenyl)sulfonyl-2-phenylpyrrolidine-3-carboxylate |
| SMILES | C=C[C@]1(c2ccc(OC)cc2)CN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)[C@@H](c2ccccc2)[C@]1(C#N)C(=O)OCC |
| InChI | InChI=1S/C29H27N3O7S/c1-4-28(22-11-15-24(38-3)16-12-22)20-31(40(36,37)25-17-13-23(14-18-25)32(34)35)26(21-9-7-6-8-10-21)29(28,19-30)27(33)39-5-2/h4,6-18,26H,1,5,20H2,2-3H3/t26-,28+,29+/m0/s1 |
| InChIKey | ZWFZZFREDYAROA-WIIGKZCBSA-N |
| XLogP | 4.55 |
| TPSA | 139.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|