C24H24N3O3+ — CID 7176813
N-[2-[[(1S)-2-methyl-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]methyl]phenyl]-4-nitrobenzamide (PubChem CID 7176813) has the molecular formula C24H24N3O3+ and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[2-[[(1S)-2-methyl-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]methyl]phenyl]-4-nitrobenzamide.
| Compound Name | N-[2-[[(1S)-2-methyl-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]methyl]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 7176813 |
| Molecular Formula | C24H24N3O3+ |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[2-[[(1S)-2-methyl-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]methyl]phenyl]-4-nitrobenzamide |
| SMILES | C[NH+]1CCc2ccccc2[C@@H]1Cc1ccccc1NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H23N3O3/c1-26-15-14-17-6-2-4-8-21(17)23(26)16-19-7-3-5-9-22(19)25-24(28)18-10-12-20(13-11-18)27(29)30/h2-13,23H,14-16H2,1H3,(H,25,28)/p+1/t23-/m0/s1 |
| InChIKey | AUNPXHDZCOENQQ-QHCPKHFHSA-O |
| XLogP | 3.20 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|