C38H71NO3 — CID 71768174
2-[[(Z)-octadec-9-enoyl]amino]ethyl (Z)-octadec-9-enoate (PubChem CID 71768174) has the molecular formula C38H71NO3 and a molecular weight of 589.99 g/mol. Its IUPAC name is 2-[[(Z)-octadec-9-enoyl]amino]ethyl (Z)-octadec-9-enoate.
| Compound Name | 2-[[(Z)-octadec-9-enoyl]amino]ethyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 71768174 |
| Molecular Formula | C38H71NO3 |
| Molecular Weight | 589.99 g/mol |
| Exact Mass | 589.54 |
| IUPAC Name | 2-[[(Z)-octadec-9-enoyl]amino]ethyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCOC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C38H71NO3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37(40)39-35-36-42-38(41)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-36H2,1-2H3,(H,39,40)/b19-17-,20-18- |
| InChIKey | HPOADJBREZVSHW-CLFAGFIQSA-N |
| XLogP | 11.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.99 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|