C21H25ClN4O — CID 71768327
N-(4-chlorophenyl)-N-(cyclopropylmethyl)-4-(3-methyl-2-pyridinyl)piperazine-1-carboxamide (PubChem CID 71768327) has the molecular formula C21H25ClN4O and a molecular weight of 384.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-(cyclopropylmethyl)-4-(3-methyl-2-pyridinyl)piperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-N-(cyclopropylmethyl)-4-(3-methyl-2-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 71768327 |
| Molecular Formula | C21H25ClN4O |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-(4-chlorophenyl)-N-(cyclopropylmethyl)-4-(3-methyl-2-pyridinyl)piperazine-1-carboxamide |
| SMILES | Cc1cccnc1N1CCN(C(=O)N(CC2CC2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H25ClN4O/c1-16-3-2-10-23-20(16)24-11-13-25(14-12-24)21(27)26(15-17-4-5-17)19-8-6-18(22)7-9-19/h2-3,6-10,17H,4-5,11-15H2,1H3 |
| InChIKey | FOSPVJDVVJYNSD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |