C16H21NO5 — CID 71768870
(E)-3-phenyl-N-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]prop-2-enamide (PubChem CID 71768870) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is (E)-3-phenyl-N-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 71768870 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (E)-3-phenyl-N-[[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]prop-2-enamide |
| SMILES | C[C@@H]1O[C@H](CNC(=O)/C=C/c2ccccc2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H21NO5/c1-10-14(19)16(21)15(20)12(22-10)9-17-13(18)8-7-11-5-3-2-4-6-11/h2-8,10,12,14-16,19-21H,9H2,1H3,(H,17,18)/b8-7+/t10-,12+,14+,15+,16+/m0/s1 |
| InChIKey | NJLORPYFUUWZNP-NPLZYVICSA-N |
| XLogP | -0.31 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|