About trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine
trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine (PubChem CID 71769137) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine.
Molecular Properties
| Compound Name | trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine |
| PubChem CID | 71769137 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine |
| SMILES | CN(C)[C@H]1CCCC[C@@H]1OCCCc1ccccc1 |
| InChI | InChI=1S/C17H27NO/c1-18(2)16-12-6-7-13-17(16)19-14-8-11-15-9-4-3-5-10-15/h3-5,9-10,16-17H,6-8,11-14H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | CLQICLOLCAXNFR-IRXDYDNUSA-N |
| XLogP | 3.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine?
The IUPAC name of trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine (CID 71769137) is trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine.
What is the SMILES notation for trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine?
The canonical SMILES for trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine is CN(C)[C@H]1CCCC[C@@H]1OCCCc1ccccc1.
What is the InChIKey of trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine?
The InChIKey is CLQICLOLCAXNFR-IRXDYDNUSA-N. The full InChI is InChI=1S/C17H27NO/c1-18(2)16-12-6-7-13-17(16)19-14-8-11-15-9-4-3-5-10-15/h3-5,9-10,16-17H,6-8,11-14H2,1-2H3/t16-,17-/m0/s1.
What are the key properties of trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine?
trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine has a molecular weight of 261.41 g/mol, XLogP of 3.51, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-N,N-dimethyl-2-(3-phenylpropoxy)cyclohexan-1-amine is sourced from PubChem (CID 71769137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).