C31H52N2O5 — CID 71769301
[(3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-(dimethylamino)-5-oxopentan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis(2-hydroxyethyl)carbamate (PubChem CID 71769301) has the molecular formula C31H52N2O5 and a molecular weight of 532.77 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-(dimethylamino)-5-oxopentan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis(2-hydroxyethyl)carbamate.
| Compound Name | [(3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-(dimethylamino)-5-oxopentan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 71769301 |
| Molecular Formula | C31H52N2O5 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.39 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-5-(dimethylamino)-5-oxopentan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis(2-hydroxyethyl)carbamate |
| SMILES | C[C@H](CCC(=O)N(C)C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)N(CCO)CCO)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H52N2O5/c1-21(6-11-28(36)32(4)5)25-9-10-26-24-8-7-22-20-23(38-29(37)33(16-18-34)17-19-35)12-14-30(22,2)27(24)13-15-31(25,26)3/h7,21,23-27,34-35H,6,8-20H2,1-5H3/t21-,23+,24+,25-,26+,27+,30+,31-/m1/s1 |
| InChIKey | SVELKCFXKPXYPF-MIXBDBMTSA-N |
| XLogP | 4.86 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|