About 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline
5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline (PubChem CID 71769729) has the molecular formula C17H9ClN2O3
and a molecular weight of 324.72 g/mol. Its IUPAC name is 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline.
Molecular Properties
| Compound Name | 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline |
| PubChem CID | 71769729 |
| Molecular Formula | C17H9ClN2O3 |
| Molecular Weight | 324.72 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline |
| SMILES | O=[N+]([O-])c1ccc(-c2cc3cc(Cl)c4cccnc4c3o2)cc1 |
| InChI | InChI=1S/C17H9ClN2O3/c18-14-8-11-9-15(10-3-5-12(6-4-10)20(21)22)23-17(11)16-13(14)2-1-7-19-16/h1-9H |
| InChIKey | DVCMIRPDLSUEAX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.72 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline?
The IUPAC name of 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline (CID 71769729) is 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline.
What is the SMILES notation for 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline?
The canonical SMILES for 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline is O=[N+]([O-])c1ccc(-c2cc3cc(Cl)c4cccnc4c3o2)cc1.
What is the InChIKey of 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline?
The InChIKey is DVCMIRPDLSUEAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9ClN2O3/c18-14-8-11-9-15(10-3-5-12(6-4-10)20(21)22)23-17(11)16-13(14)2-1-7-19-16/h1-9H.
What are the key properties of 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline?
5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline has a molecular weight of 324.72 g/mol, XLogP of 5.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(4-nitrophenyl)furo[3,2-h]quinoline is sourced from PubChem (CID 71769729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).