About furan-2-ylmethylthiourea
furan-2-ylmethylthiourea (PubChem CID 717699) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is furan-2-ylmethylthiourea.
Molecular Properties
| Compound Name | furan-2-ylmethylthiourea |
| PubChem CID | 717699 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | furan-2-ylmethylthiourea |
| SMILES | NC(=S)NCc1ccco1 |
| InChI | InChI=1S/C6H8N2OS/c7-6(10)8-4-5-2-1-3-9-5/h1-3H,4H2,(H3,7,8,10) |
| InChIKey | XSWHIPZJAMCLRZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze furan-2-ylmethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-ylmethylthiourea?
The IUPAC name of furan-2-ylmethylthiourea (CID 717699) is furan-2-ylmethylthiourea.
What is the SMILES notation for furan-2-ylmethylthiourea?
The canonical SMILES for furan-2-ylmethylthiourea is NC(=S)NCc1ccco1.
What is the InChIKey of furan-2-ylmethylthiourea?
The InChIKey is XSWHIPZJAMCLRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c7-6(10)8-4-5-2-1-3-9-5/h1-3H,4H2,(H3,7,8,10).
What are the key properties of furan-2-ylmethylthiourea?
furan-2-ylmethylthiourea has a molecular weight of 156.21 g/mol, XLogP of 0.61, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethylthiourea is sourced from PubChem (CID 717699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).