About methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride
methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride (PubChem CID 71769911) has the molecular formula C18H25Cl2NO3
and a molecular weight of 374.31 g/mol. Its IUPAC name is methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride |
| PubChem CID | 71769911 |
| Molecular Formula | C18H25Cl2NO3 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride |
| SMILES | COC(=O)CCCCNC1(c2ccccc2Cl)CCCCC1=O.Cl |
| InChI | InChI=1S/C18H24ClNO3.ClH/c1-23-17(22)11-5-7-13-20-18(12-6-4-10-16(18)21)14-8-2-3-9-15(14)19;/h2-3,8-9,20H,4-7,10-13H2,1H3;1H |
| InChIKey | WXBJRXSGJVAOFU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride?
The IUPAC name of methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride (CID 71769911) is methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride.
What is the SMILES notation for methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride?
The canonical SMILES for methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride is COC(=O)CCCCNC1(c2ccccc2Cl)CCCCC1=O.Cl.
What is the InChIKey of methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride?
The InChIKey is WXBJRXSGJVAOFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24ClNO3.ClH/c1-23-17(22)11-5-7-13-20-18(12-6-4-10-16(18)21)14-8-2-3-9-15(14)19;/h2-3,8-9,20H,4-7,10-13H2,1H3;1H.
What are the key properties of methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride?
methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride has a molecular weight of 374.31 g/mol, XLogP of 4.03, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[1-(2-chlorophenyl)-2-oxocyclohexyl]amino]pentanoate;hydrochloride is sourced from PubChem (CID 71769911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).