C27H33N7O2 — CID 71770185
2-(4-benzylpiperazin-1-yl)-N'-[2-[bis(pyridin-2-ylmethyl)amino]acetyl]acetohydrazide (PubChem CID 71770185) has the molecular formula C27H33N7O2 and a molecular weight of 487.61 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N'-[2-[bis(pyridin-2-ylmethyl)amino]acetyl]acetohydrazide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N'-[2-[bis(pyridin-2-ylmethyl)amino]acetyl]acetohydrazide |
|---|---|
| PubChem CID | 71770185 |
| Molecular Formula | C27H33N7O2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N'-[2-[bis(pyridin-2-ylmethyl)amino]acetyl]acetohydrazide |
| SMILES | O=C(CN1CCN(Cc2ccccc2)CC1)NNC(=O)CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C27H33N7O2/c35-26(21-33-16-14-32(15-17-33)18-23-8-2-1-3-9-23)30-31-27(36)22-34(19-24-10-4-6-12-28-24)20-25-11-5-7-13-29-25/h1-13H,14-22H2,(H,30,35)(H,31,36) |
| InChIKey | UBFPFEYJQOUETN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|