About 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one
8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one (PubChem CID 71770295) has the molecular formula C16H10FNO3
and a molecular weight of 283.26 g/mol. Its IUPAC name is 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one.
Molecular Properties
| Compound Name | 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
| PubChem CID | 71770295 |
| Molecular Formula | C16H10FNO3 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
| SMILES | O=c1cc(-c2cccc(F)c2)c2cc3c(cc2[nH]1)OCO3 |
| InChI | InChI=1S/C16H10FNO3/c17-10-3-1-2-9(4-10)11-6-16(19)18-13-7-15-14(5-12(11)13)20-8-21-15/h1-7H,8H2,(H,18,19) |
| InChIKey | CHWHQUFUXUWSLL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one?
The IUPAC name of 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one (CID 71770295) is 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one.
What is the SMILES notation for 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one?
The canonical SMILES for 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one is O=c1cc(-c2cccc(F)c2)c2cc3c(cc2[nH]1)OCO3.
What is the InChIKey of 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one?
The InChIKey is CHWHQUFUXUWSLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FNO3/c17-10-3-1-2-9(4-10)11-6-16(19)18-13-7-15-14(5-12(11)13)20-8-21-15/h1-7H,8H2,(H,18,19).
What are the key properties of 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one?
8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one has a molecular weight of 283.26 g/mol, XLogP of 3.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-fluorophenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-6-one is sourced from PubChem (CID 71770295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).