C31H44N6O4 — CID 71770332
[2-[2-[(4-cyclohexylphenyl)methylamino]-6-(3-methylbutylamino)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 71770332) has the molecular formula C31H44N6O4 and a molecular weight of 564.73 g/mol. Its IUPAC name is [2-[2-[(4-cyclohexylphenyl)methylamino]-6-(3-methylbutylamino)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2-[2-[(4-cyclohexylphenyl)methylamino]-6-(3-methylbutylamino)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71770332 |
| Molecular Formula | C31H44N6O4 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.34 |
| IUPAC Name | [2-[2-[(4-cyclohexylphenyl)methylamino]-6-(3-methylbutylamino)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)CCNc1nc(NCc2ccc(C3CCCCC3)cc2)nc2c1ncn2CC(=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C31H44N6O4/c1-21(2)15-16-32-27-26-28(37(19-34-26)18-25(38)40-20-41-29(39)31(3,4)5)36-30(35-27)33-17-22-11-13-24(14-12-22)23-9-7-6-8-10-23/h11-14,19,21,23H,6-10,15-18,20H2,1-5H3,(H2,32,33,35,36) |
| InChIKey | WIGPSAFPPXXTGP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|