C31H38N6O5 — CID 71770333
[2-[2-[(4-cyclohexylphenyl)methylamino]-6-(furan-2-ylmethylamino)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 71770333) has the molecular formula C31H38N6O5 and a molecular weight of 574.68 g/mol. Its IUPAC name is [2-[2-[(4-cyclohexylphenyl)methylamino]-6-(furan-2-ylmethylamino)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2-[2-[(4-cyclohexylphenyl)methylamino]-6-(furan-2-ylmethylamino)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71770333 |
| Molecular Formula | C31H38N6O5 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | [2-[2-[(4-cyclohexylphenyl)methylamino]-6-(furan-2-ylmethylamino)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)Cn1cnc2c(NCc3ccco3)nc(NCc3ccc(C4CCCCC4)cc3)nc21 |
| InChI | InChI=1S/C31H38N6O5/c1-31(2,3)29(39)42-20-41-25(38)18-37-19-34-26-27(32-17-24-10-7-15-40-24)35-30(36-28(26)37)33-16-21-11-13-23(14-12-21)22-8-5-4-6-9-22/h7,10-15,19,22H,4-6,8-9,16-18,20H2,1-3H3,(H2,32,33,35,36) |
| InChIKey | ZAVWNBADYPORIO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|