C32H37FN6O4 — CID 71770334
[2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-fluoroanilino)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 71770334) has the molecular formula C32H37FN6O4 and a molecular weight of 588.68 g/mol. Its IUPAC name is [2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-fluoroanilino)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-fluoroanilino)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 71770334 |
| Molecular Formula | C32H37FN6O4 |
| Molecular Weight | 588.68 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | [2-[2-[(4-cyclohexylphenyl)methylamino]-6-(4-fluoroanilino)purin-9-yl]acetyl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)Cn1cnc2c(Nc3ccc(F)cc3)nc(NCc3ccc(C4CCCCC4)cc3)nc21 |
| InChI | InChI=1S/C32H37FN6O4/c1-32(2,3)30(41)43-20-42-26(40)18-39-19-35-27-28(36-25-15-13-24(33)14-16-25)37-31(38-29(27)39)34-17-21-9-11-23(12-10-21)22-7-5-4-6-8-22/h9-16,19,22H,4-8,17-18,20H2,1-3H3,(H2,34,36,37,38) |
| InChIKey | NHJIDPOYFOOHFT-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|