C14H21NO7S — CID 71770443
4-methyl-N-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]benzenesulfonamide (PubChem CID 71770443) has the molecular formula C14H21NO7S and a molecular weight of 347.39 g/mol. Its IUPAC name is 4-methyl-N-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71770443 |
| Molecular Formula | C14H21NO7S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-methyl-N-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C14H21NO7S/c1-8-2-4-9(5-3-8)23(20,21)15-6-10-12(17)14(19)13(18)11(7-16)22-10/h2-5,10-19H,6-7H2,1H3/t10-,11+,12-,13+,14+/m0/s1 |
| InChIKey | GMRMUSPZXGYVBM-MEBFFEOJSA-N |
| XLogP | -1.88 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |